Stoichiometry
Stoichiometry
So it's 2 moles. And since 1 mole is NA molecules, there are 2 x NA = 1.2 x 1024 molecules.
The key to solving these problems is getting the g/mol (molar mass, or amus) of the substance, and then
using that in a DA setup to convert back and forth between grams and moles. One amu is one g/mol.
Example:
The answer is .025 moles. Be careful to use DA correctly, and that you will
have to flip it so that the units in the top and bottom cancel out.
Example:
You have a sample of glucose (C6H12O6), that weighs 2.5 grams. How many
carbon molecules are in it?
Answer
Find the number of moles of glucose (we already found molar mass of
glucose in last problem, 180.1.)
In each glucose molecule there are six carbons. So if you have .014 moles
of glucose, you must have 6 times as many carbons in it. .014 moles x 6
= .084 moles C. Just multiply it by Avogadro's number to get the answer.
.084 moles x 6.022 x 1023=5.1 x 1022 carbon molecules.
Percent Mass
This is just another way to show how much of something is in a compound. It's how much of the substance
is made of one particular element, the percent by mass (I bet you could figure that out by the title). So if
there is 60 g of something, and in that compound there is 12 g of carbon, then you would say the percent
mass is 20% (12 g / 60 g x 100%).
Note that this number can't be directly obtained from the moles. Percent moles is not the percent mass too.
You must convert or die.
Example:
Answer
Let's find the molecular mass of the empirical formula.
12.01 g/mol x 2 + 1.008 g/mol x 3 + 16.00 g/mol x 4 = 91.04 g / mol.
And since the molecular formula is just a multiple of the empirical, let's
see if 273.1 g / mol is a multiple of 91.04 g / mol.
273.1 g/mol / 91.04 g/mol = 3.000.
Sure enough, the number goes divides almost evenly three times. That
means the molecular must have three times the number of particles of the
empirical. Multiplying each by three gives the molecular formula to be
C6H9O12.
It's important to remember that the molecular formula is a multiple of the empirical formula in both
subscripts and molar masses.
Chemical Equations and Balancing Them
A chemical reaction is when one or more molecules rearrange their atoms to form new molecules. Here is an
example:
CH4 + O2 ---> CO2 + H2O
You can see this visually below:
Methane
->
Oxygen
Carbon Dioxide
Water
The things on the left side are called the reactants, and the things on the right are called the products. The
reactants are generally transformed into the products until one of the reactants runs out, or the system
reaches equilibrium (a balance).
As another example, if you wanted to say that two molecules combine to form one, just use the coefficients.
Just like in algebra, you can put numbers in front of the molecule to show how many of them are in the
equation. Let's say 2 of Molecule A and 3 of Molecule B are needed to make 4 of Molecule C. The equation
would look like:
2A + 3B ---> 4C
Another thing that's important to right down is what state each reactant and product is, by little subscript
letters. The symbols are:
Solid: (s)
Liquid: (l) (When you write it by hand, it's a lowercase cursive l.)
Gas: (g)
Now the hydrogens are balanced, but the oxygens aren't. Now we have 4 on right and 2 on left. Multiply
atom with oxygen on left by two:
CH4 (g) + 2O2 (g) ---> CO2 (g) + 2H2O (g)
If you count them, everything adds up. There are the same number of atoms on the left as on the right.
That is the correct chemical equation.
Here is The Art of Balancing Instruction Manual, by none other than Takalah:
Example:
The unbalanced reaction is: C6H12O6 (s) + O2 (g) ---> CO2 (g) + H2O (g)
The most complicated atom is H, since it's in glucose and water, and
that the subscripts are the largest. Let's see; there are 12 on the
left and 2 on the right, so let's try multiplying right by 6:
C6H12O6 (s) + O2 (g) ---> CO2 (g) + 6H2O (g)
Now you move on to the next complicated atom; C, since it's in both
carbon dioxide and glucose. There are six on left, and one on right;
try multiplying right one by 6. You get:
C6H12O6 (s) + O2 (g) ---> 6CO2 (g) + 6H2O (g)
Everything is basically done now, you got have to finish it by
balancing oxygens using the O2 molecule. There's 6 on left; and
6x2+6 = 18 on right. (Remember that you have to multiply
coefficient by subscript to get number of atoms.) So there must be
12 atoms on right to balance it. Twelve oxygen atoms is 6 oxygen
molecules, so the final answer is:
C6H12O6 (s) + 6O2 (g) ---> 6CO2 (g) + 6H2O (g)
You have to remember the stuff you learned in the last part to do
this. Indium (III) oxide is In2O3. So the equation is:
In (s) + O2 (g) ---> In2O3 (g)
Start with the most complicated one, which is oxygen. Multiplying
left by three and right by two gives
In (s) + 3O2 (g) ---> 2In2O3 (g)
Now to balance In's, there are four total In's on right. So there must
be 4 In's in left. Answer is:
Stoichiometric Calculations
One thing to realize when doing any calculations is that moles and coefficients are interchangeable. Both
mean number of particles, or multiples thereof. So in 2A + 3B ---> 4C, it either means 2 particles of A
combine with 3 particles of B to make 4 particles of C, or 2 moles reacts with 3 moles to make 4 moles.
With that in mind, here is a simple problem.
Example:
The formation of water from hydrogen and oxygen gas is: 2H 2 (g) + O2 (g) --> 2H2O (l). What mass of water will form from 12.0 grams of hydrogen and
excess oxygen (assuming the reaction goes to completion?)
Answer
First what you must do in any of these problems is get all given masses
into moles. You are given 12.0 grams of hydrogen, let's see how many
moles that is:
The "oxygen in excess" is important. We're assuming that there's tons of oxygen, enough to supply
whatever the hydrogen needs. If there was only .0000000000000000000001 moles of oxygen, 5.94 moles
of water obviously can't form.
Let's try one more of this type before moving on to LRs.
Example:
In these last two problems, we always assumed that one of the reactants was in excess. This simplified
things, but it's often not the case in many reactions. You have given amounts of each reactant. So how do
you do this? Simple, just find out which out runs out first molewise. The one that does is called the limiting
reactant, or just LR. One quick example:
Example:
Note that mole ratios are important. Let's say 2 Tak's become 1 Asdf. Then it becomes a little bit more than
just finding the bigger number, but not very harder. You start with one, say, Tak. Assume that it is the LR.
Then, according to the mole ratio, you would need at least half as much Asdf for Tak to become the LR. Do
you have a half? Well, one-half of .109 moles is about .05 something, and you do have that much. So if Asdf
isn't your LR, then Tak must be. (Of course if it was exactly equal to half, then you could use either one,
there would be no LR, and everything gets used up.)
What happens if you started with looking at Asdf? Well you need twice as much Asdf's. Twice .0890 is .17
something. You don't have that much Tak, therefore Tak is your LR, no matter how you look at it.
Once you find the LR, you can go ahead and finish the problem just like the others. So what's the
difference? Once you find the LR, you use that amount and throw away the other amount. So like in the
above example, you use the .0890 value, and forget about the .109. Of course, if they ask you to refer to
the original amount, such as how much reactant is left over, then you need to use it. But not for stoich.
Example:
Percent Yield
One little thing. You can test the above stuff in a lab, like measuring out the reactants, and see if you get
the calculated amount of product. You probably won't get the exact number, but rather a number that's
below it. There could be many reasons for it, such as maybe the reaction doesn't go to completion, or
maybe there's impurities or something. The theoretical yield is how much you should get, according to
stoich. The actual yield is how much you actually get, determined in a lab. The percent yield is the ratio of
these two. The equation:
Yields are masswise. That is, how much you get is measured in kilograms, grams, mass.
Note that the percent yield will always be under 100%. The theoretical yield is the max you can get. (You're
not going to get more substance than calculations predict.)
Now it's time for the big example, that ties together balancing equations, stoich, LRs, and percent yield.
Example:
1a) How many moles of chlorine gas (Cl2) would react with 5 moles of sodium (Na)
according to the following chemical equation? (Balance equation.)
2Na + Cl2 --> 2NaCl
[5 mol Na][1 mol Cl2] = 2.5 mol Cl2
[2 mol Na]
1b) Using the equation (after it is balanced) above, determine the amount of product that
can be produced from 24.7 g Na.
[24.7g Na][1 mol Na][2 mol NaCl][58g NaCl ] = 62 g NaCl
[23 g Na ][2 mol Na ][1 mol NaCl]
1c) How many molecules of product would be produced from 24.7g Na?
[24.7g Na][1 mol Na][2 mol NaCl][6.023 E23 molecules NaCl ] = 6.5 E23 NaCl
[23 g Na ][2 mol Na ][1 mol NaCl
]
molecules
________________________________________________________________________
__________
2a) In the reaction 2C8H18 + 25O2 --> 16CO2 + 18 H2O, the ratio of volumes of O2 to
CO2 is
25:16
2b) If 27.3g of C8H18 are combusted, what mass of water will be produced?
[27.3 g C8H18][1 mol C8H18 ][18 mol H2O][18g H2O ] = 37.8 g H2O
[114g C8H18 ][2 mol C8H18][1 mol H2O]
2c) How many molecules of CO2 will be produced?
[27.3 g C8H18][1 mol C8H18 ][16mol CO2 ][6.023 E23 molecules CO2 ] = 1.15 E24
[114g C8H18 ][2 mol C8H18][1 mol CO2]
molecules CO2
2d) How many atoms of H are in 2 mol of C8H18?
[2 mol C8H18][6.023 E23 molecules C8H18][18 atoms H
[1 mol C8H18
][1 molecule C8H18 ]
Stoichiometry is a section of chemistry that involves using relationships between reactants and/or products in a
chemical reaction to determine desired quantitative data. In Greek,stoikhein means element and metron means
measure, so stoichiometry literally translated means the measure of elements. In order to use stoichiometry to run
calculations about chemical reactions, it is important to first understand the relationships that exist between products
and reactants and why they exist, which require understanding how to balanced reactions.
Balancing
In chemistry, chemical reactions are frequently written as an equation, using chemical symbols. The reactants are
displayed on the left side of the equation and the products are shown on the right, with the separation of either a
single or double arrow that signifies the direction of the reaction. The significance of single and double arrow is
important when discussing solubility constants, but we will not go into detail about it in this module. To balance an
equation, it is necessary that there are the same number of atoms on the left side of the equation as the right. One
can do this by raising the coefficients.
Reactants to Products
A chemical equation is like a recipe for a reaction so it displays all the ingredients or terms of a chemical reaction. It
includes the elements, molecules, or ions in the reactants and in the products as well as their states, and the
proportion for how much of each particle is create relative to one another, through the stoichiometric coefficient. The
following equation demonstrates the typical format of a chemical equation:
2Na(s)+2HCl(aq)2NaCl(aq)+H2(g)(1)
In the above equation, the elements present in the reaction are represented by their chemical symbols. Based on
the Law of Conservation of Mass, which states that matter is neither created nor destroyed in a chemical reaction,
every chemical reaction has the same elements in its reactants and products, though the elements they are paired up
with often change in a reaction. In this reaction, sodium ( Na), hydrogen (H), and chloride (Cl) are the elements
present in both reactants, so based on the law of conservation of mass, they are also present on the product side of
the equations. Displaying each element is important when using the chemical equation to convert between elements.
Stoichiometric Coefficients
In a balanced reaction, both sides of the equation have the same number of elements. The stoichiometric coefficient
is the number written in front of atoms, ion and molecules in a chemical reaction to balance the number of each
element on both the reactant and product sides of the equation. Though the stoichiometric coefficients can be
fractions, whole numbers are frequently used and often preferred. This stoichiometric coefficients are useful since
they establish the mole ratio between reactants and products. In the balanced equation:
2Na(s)+2HCl(aq)2NaCl(aq)+H2(g)(2)
we can determine that 2 moles of HCl will react with 2 moles of Na(s) to form 2 moles of NaCl(aq) and 1 mole
of H2(g). If we know how many moles of
Na we start out with, we can use the ratio of 2 moles of NaCl to 2 moles of
Na to determine how many moles of NaClwere produced or we can use the ration of 1 mole of H2 to 2 moles
of Na to convert to NaCl. This is known as the coefficient factor. The balanced equation makes it possible to
convert information about one reactant or product to quantitative data about another element. Understanding this is
essential to solving stoichiometric problems.
Example 1
Lead (IV) hydroxide and sulfuric acid react as shown below. Balance the reaction.
Pb(OH)4+H2SO4Pb(SO4)2+H2O
SOLUTION
Start by counting the number of atoms of each element.
UNBALANCED
Element
Reactant (# of atoms)
Product (# of atoms)
Pb
The reaction is not balanced; the reaction has 16 reactant atoms and only 14 product atoms and does not obey the
conservation of mass principle. Stoichiometric coefficients must be added to make the equation balanced. In this
example, there are only one sulfur atom present on the reactant side, so a coefficient of 2 should be added in front
of H2SO4 to have an equal number of sulfur on both sides of the equation. Since there are 12 oxygen on the
reactant side and only 9 on the product side, a 4 coefficient should be added in front of
deficiency of oxygen. Count the number of elements now present on either side of the equation. Since the numbers
are the same, the equation is now balanced.
Pb(OH)4+2H2SO4Pb(SO4)2+4H2O
BALANCED
Element
Reactant (# of atoms)
Product (# of atoms)
Pb
12
12
Balancing reactions involves finding least common multiples between numbers of elements present on both sides of
the equation. In general, when applying coefficients, add coefficients to the molecules or unpaired elements last.
A balanced equation ultimately has to satisfy two conditions.
1.
2.
The numbers of each element on the left and right side of the equation must be equal.
The charge on both sides of the equation must be equal. It is especially important to pay attention to charge
when balancing redox reactions.
Example 2
There are 12 party invitations and 20 stamps. Each party invitation needs 2 stamps to be sent. How many party
invitations can be sent?
SOLUTION
The equation for this can be written as
I+2SIS2
where
I represents invitations,
S represents stamps, and
IS2 represents the sent party invitations consisting of one invitation and two stamps.
Based on this, we have the ratio of 2 stamps for 1 sent invite, based on the balanced equation.
Invitations
Stamps
In this example are all the reactants (stamps and invitations) used up? No, and this is normally the case with
chemical reactions. There is often excess of one of the reactants. The limiting reagent, the one that runs out first,
prevents the reaction from continuing and determines the maximum amount of product that can be formed.
Example 3
What is the limiting reagent in this example?
SOLUTION
Stamps, because there was only enough to send out invitations, whereas there were enough invitations for 12
complete party invitations. Aside from just looking at the problem, the problem can be solved
using stoichiometric factors.
12 I x (1IS2/1I) = 12 IS2 possible
20 S x (1IS2/2S) = 10 IS2 possible
When there is no limiting reagent because the ratio of all the reactants caused them to run out at the same time, it is
known asstoichiometric proportions.
Types of Reactions
There are 6 basic types of reactions.
Combustion: Combustion is the formation of CO2 and H2O from the reaction of a chemical and O2
Combination (synthesis): Combination is the addition of 2 or more simple reactants to form a complex
product.
Decomposition: Decomposition is when complex reactants are broken down into simpler products.
Single Displacement: Single displacement is when an element from on reactant switches with an element
Molar Mass
Before applying stoichiometric factors to chemical equations, you need to understand molar mass. Molar mass is a useful
chemical ratio between mass and moles. The atomic mass of each individual element as listed in the periodic table established
this relationship for atoms or ions. For compounds or molecules, you have to take the sum of the atomic mass times the number
of each atom in order to determine the molar mass
Example 4
What is the molar mass of H2O?
SOLUTION
Molar mass=2(1.00794g/mol)+1(15.9994g/mol)=18.01528g/mol
Using molar mass and coefficient factors, it is possible to convert mass of reactants to mass of products or vice
versa.
C3H8+5O24H2O+3CO2
If 200 g of propane is burned, how many g of H2O is produced?
SOLUTION
Steps to getting this answer: Since you cannot calculate from grams of reactant to grams of products you must
convert from grams of C3H8 to moles of C3H8 then from moles of C3H8 to moles of H2O. Then convert from moles
of H2O to grams of H2O.
Step 1:
Step 2:
Since there is a ratio of 4:1 H2O to C3H8, for every 4.54 mol C3H8 there are 18.18 mol H2O.
Step 3:
Convert 18.18 mol H2O to g H2O. 18.18 mol H2O is equal to 327.27 g H2O.
Almost every quantitative relationship can be converted into a ratio that can be useful in data analysis.
Density
Density () is calculated as mass/volume. This ratio can be useful in determining the volume of a solution, given the
mass or useful in finding the mass given the volume. In the latter case, the inverse relationship would be used.
Volume x (Mass/Volume) = Mass
Mass x (Volume/Mass) = Volume
Percent Mass
Percents establish a relationship as well. A percent mass states how many grams of a mixture are of a certain
element or molecule. The percent X% states that of every 100 grams of a mixture, X grams are of the stated element
or compound. This is useful in determining mass of a desired substance in a molecule.
Example 6
A substance is 5% carbon by mass. If the total mass of the substance is 10 grams, what is the mass of carbon in the
sample? How many moles of carbon are there?
SOLUTION
10 g sample x (5 g carbon/100 g sample) = 0.5 g carbon
0.5g carbon x (1 mol carbon/12.011g carbon) = 0.0416 mol carbon
Molarity
Molarity (moles/L) establishes a relationship between moles and liters. Given volume and molarity, it is possible to calculate
mole or use moles and molarity to calculate volume. This is useful in chemical equations and dilutions.
Example 7
How much 5 M stock solution is needed to prepare 100 mL of 2 M solution?
SOLUTION
100 mL of dilute solution (1 L/1000 mL)(2 mol/1L solution)(1 L stock solution/5 mol solution)(1000 ml stock solution/1L
stock solution) = 40 mL stock solution.
These ratios of molarity, density, and mass percent are useful in complex examples ahead.
CxHyOz(g)+O2(g)CO2(g)+H2O(g)
Since all the moles of C and H in CO2 and H2O, respectively have to have came from the 1 gram sample of unknown,
start by calculating how many moles of each element were present in the unknown sample.
0.0333mol CO2 (1mol C/ 1mol CO2) = 0.0333mol C in unknown
0.599g H2O (1mol H2O/ 18.01528g H2O)(2mol H/ 1mol H2O) = 0.0665 mol H in unknown
Calculate the final moles of oxygen by taking the sum of the moles of oxygen in CO 2 and H2O. This will give you the
number of moles from both the unknown organic molecule and the O 2 so you must subtract the moles of oxygen
transferred from the O2.
Moles of oxygen in CO2:
0.0333mol CO2 (2mol O/1mol CO2) = 0.0666 mol O
Moles of oxygen in H2O:
0.599g H2O (1mol H2O/18.01528 g H2O)(1mol O/1mol H2O) = 0.0332 mol O
Using the Law of Conservation, we know that the mass before a reaction must equal the mass after a reaction. With
this we can use the difference of the final mass of products and initial mass of the unknown organic molecule to
determine the mass of the O2 reactant.
0.333mol CO2(44.0098g CO2/ 1mol CO2) = 1.466g CO2
1.466g CO2 + 0.599g H2O - 1.000g unknown organic = 1.065g O2
Moles of oxygen in O2
Example 9
In the example above, it was determined that the unknown molecule had an empirical formula of CH2O.
1. Find the molar mass of the empircal formula CH2O.
12.011g C + (1.008 g H) * (2 H) + 15.999g O = 30.026 g/mol CH2O
2. Determine the molecular mass experimentally. For our compound, it is 120.056 g/mol.
3. Divide the experimentally determined molecular mass by the mass of the empirical formula.
(120.056 g/mol) / (30.026 g/mol) = 3.9984
4. Since 3.9984 is very close to four, it is possible to safely round up and assume that there was a slight error in the
experimentally determined molecular mass. If the answer is not close to a whole number, there was either an error in
the calculation of the empirical formula or a large error in the determination of the molecular mass.
5. Multiply the ratio from step 4 by the subscripts of the empirical formula to get the molecular formula.
CH2O * 4 = ?
C: 1 * 4 = 4
H: 2 * 4 = 8
O1*4=4
CH2O * 4 = C4H8O4
6. Check your result by calculating the molar mass of the molecular formula and comparing it to the experimentally
determined mass.
molar mass of C4H8O4= 120.104 g/mol
experimentally determined mass = 120.056 g/mol
% error = | theoretical - experimental | / theoretical * 100%
% error = | 120.104 g/mol - 120.056 g/mol | / 120.104 g/mol * 100%
% error = 0.040 %
Fe(s)+2H+(aq)H2(g)+Fe2+(aq)
Step 2: Write down all the given information
Alloy density = (3.15g alloy/ 1L alloy)
x grams of alloy = 45% copper = (45g Cu(s)/100g alloy)
x grams of alloy = 55% iron(II) = (55g Fe(s)/100g alloy)
1 liter alloy = 1000cm3 alloy
alloy sample = 1.203cm3 alloy
Step 3: Answer the question of what is being asked. The question asks how much H2(g) was produced. You are
expected to solve for the amount of product formed.
Step 4: Start with the compound you know the most about and use given ratios to convert it to the desired
compound.
Convert the given amount of alloy reactant to solve for the moles of Fe(s) reacted.
1.203cm3 alloy(1liter alloy/1000cm3 alloy)(3.15g alloy/1liter alloy)(55g Fe(s)/100g alloy)(1mol Fe(s)/55.8g Fe(s))=3.74
x 10-5 mol Fe(s)
Make sure all the units cancel out to give you moles of Fe(s). The above conversion involves using
multiple stoichiometric relationships from density, percent mass, and molar mass.
The balanced equation must now be used to convert moles of Fe(s) to moles of H2(g). Remember that the balanced
equation'scoeffiecients state the stoichiometric factor or mole ratio of reactants and products.
3.74 x 10-5 mol Fe (s) (1mol H2(g)/1mol Fe(s)) = 3.74 x 10-5 mol H2(g)
Step 5: Check units
The question asks for how many grams of H2(g) were released so the moles of H2(g) must still be converted to grams
using the molar mass of H2(g). Since there are two H in each H2, its molar mass is twice that of a single H atom.
molar mass = 2(1.00794g/mol) = 2.01588g/mol
3.74 x 10-5 mol H2(g) (2.01588g H2(g)/1mol H2 (g)) = 7.53 x 10-5 g H2(g) released
Problems
Stoichiometry and balanced equations make it possible to use one piece of information to calculate another. There are countless
ways stoichiometry can be used in chemistry and everyday life. Try and see if you can use what you learned to solve the
following problems.
1) Why are the following equations not considered balanced?
a.
H2O(l)H2(g)+O2(g)
b.
Zn(s)+Au+(aq)Zn2+(aq)+Ag(s)
2) Hydrochloric acid reacts with a solid chunk of aluminum to produce hydrogen gas and aluminum ions. Write the balanced
chemical equation for this reaction.
3) Given a 10.1M stock solution, how many mL must be added to water to produce 200 mL of 5M solution?
4) If 0.502g of methane gas react with 0.27g of oxygen to produce carbon dioxide and water, what is the limiting reagent and how
many moles of water are produced? The unbalanced equation is provided below.
CH4(g)+O2(g)CO2(g)+H2O(l)
5) A 0.777g sample of an organic compound is burned completely. It produces 1.42g CO 2 and 0.388g H2O. Knowing
that all the carbon and hydrogen atoms in CO 2 and H2O came from the 0.777g sample, what is the empirical formula
of the organic compound?