Legetafo Innovative Boarding Academy

"Grade 10 Chemistry Final Exam – 2nd Semester (2017 E.C.)"

Time allowed: 90 min
Name _____________________________Roll No___________sec._______
I. Write 'True' if the statement is correct or 'False' if the statement is incorrect in the space
provided."(1 points each)
1. The blast furnace uses cryolite to reduce the melting point of iron ore.
2. Blister copper is a pure form of copper obtained directly from its ore.
3. Nitrogen is extracted from air using electrolysis.
4. Red phosphorus is more stable than white phosphorus and is stored under water.
5. Chlorine is produced by the electrolysis of brine and is used as a oxidizing agent.
6. According to the theory of vitalism, organic compounds can only be synthesized in living
organisms and not in the laboratory.
7. A functional group is responsible only for the chemical properties of organic compounds.
8. Hydrocarbons that contain both double and triple bonds are considered saturated.
9. The difference between members of a homologous series is always a CH₄ unit.
10. Alkanes typically undergo addition reactions because they contain only single bonds.
II. Choose the correct answer from the given alternatives and then, write the letter
of your choice on the space provided (1 pt each)
1. The first organic compound that is artificially synthesized from inorganic starting
materials is_____________.
A. benzene B. methane C. urea D. hydrocarbons
2. Which of the following hydrocarbons does not belong to the homologous series
of alkanes?
A. C3H8 B. C8H18 C. C6H10 D. C10H22
3. Which of the following alkanes is a liquid at room temperature?
A. CH4 B. C10H22 C. C4H10 D. C20H42
4. The hydrocarbon used as a fuel in an oxyacetylene torch is:
A. C2H2 B. C2H4 C. C4H10 D. CH4
5. The general formula that represents the olefin homologous series is:
A. CnH2n+1 B. CnH2n+2 C. CnH2n–2 D. CnH2n
6. The most common reaction that alkenes undergo is:
A. elimination B. substitution C. addition D. decomposition
7. A compound having molecular formula C7H8 that does not decolorize Br2 in CCl4 or KMnO4
solution most likely belongs to a class of hydrocarbons called _______
A. Alkynes B. Alkanes C. Alkenes D. Aromatic hydrocarbons
8. Which hydrocarbon is the main constituent of natural gas and biogas?
A. C4H10 B. CH4 C. C2H6 D. C6H14
9. The following reaction can be classified as:
CH4 + Br2 → CH3Br + HBr
A. an addition reaction B. an elimination reaction
C. a substitution reaction D. a saponification reaction
10. The first organic compound was synthesized in the laboratory by:
A. Friedrich Wohler B. A. Kekule C. John Dalton D. Wurtz
11. Which reagent is used to test for unsaturation of hydrocarbons?
A. Wurtz reagent B. Bromine in CCl4 C. Alkaline KMnO4 D. B & C
12. Which of the following is the correct general formula for alkynes?
A. CₙH₂ₙ B. CₙH₂ₙ₊₂ C. CₙH₂ₙ₋₂ D. CₙH₂ₙ₋₄
13. Which of the following is a position isomer of 1-pentyne?
A. 2-pentyne B. 3-methyl-1-butyne C. 1-butyne D. 2-methyl-2-butene
14. Which of the following is a chain isomer of 1-pentyne?
A. 2-pentyne B. 3-methyl-1-butyne C. 1-hexyne D. But-2-yne
15. Which of the following reactions represents partial hydrogenation of an alkyne?
A. Ethyne + H₂ → Ethane
B. 2-butyne + H₂ (Lindlar’s catalyst) → 2-butene
C. Propyne + H₂ → Propane
D. Ethene + H₂ → Ethane
16. Which of the following correctly gives the trimerization product of acetylene when
heated to 600–700°C?
A. Cyclopropane B. Benzene C. Ethene D. Propene
17. Which statement is true regarding isomerism in alkynes?
A. Alkynes can show geometrical isomerism.
B. Chain and position isomerism are not possible in alkynes.
C. Alkynes can show chain and position isomerism.
D. Alkynes have the same isomerism as alkanes only
18. Which of the following statements correctly differentiates an alkene from an alkane?
A. Alkenes are saturated hydrocarbons while alkanes are unsaturated.
B. Alkenes undergo substitution reactions while alkanes undergo addition reactions.
C. Alkenes have a carbon–carbon double bond while alkanes do not.
D. Alkenes are less reactive than alkanes.
19. What type of isomerism is observed in cis-2-butene and trans-2-butene?
A. Chain isomerism B. Functional group isomerism
C. Position isomerism D. Geometrical isomerism
20. Which test can be used to detect the presence of a carbon–carbon double bond in an alkene?
A. Bromine water test B. Benedict’s test
C. Tollen’s reagent D. Flame test
21. Which method is used in the laboratory to prepare ethene from ethanol?
A. Dehydrohalogenation B. Dehydration C. Hydrogenation D. Polymerization
22. What type of reaction occurs when ethene reacts with H₂ in the presence of a nickel catalyst?
A. Elimination B. Substitution C. Addition D. Combustion
23. Which of the following best describes the chemical reactivity of alkanes?
A. Highly reactive with acids and bases
B. Very reactive with biological molecules
C. Chemically inert to most reagents
D. reacts readily with water and alcohols
24. What is the correct sequence of steps in the photochemical substitution reaction of
alkanes?
A. Propagation → Termination → Initiation
B. Initiation → Termination → Propagation
C. Initiation → Propagation → Termination
D. Termination → Initiation → Propagation
25. What type of reaction leads to the formation of unsaturated hydrocarbons from alkanes?
A. Addition reaction B. Substitution reaction
C. Elimination reaction D. Polymerization
26. Which of the following is a laboratory method for preparing alkanes?
A. Fractional distillation of crude oil B. Electrolysis of brine
C. Hydrogenation of alkenes D. Neutralization of acids and bases
27. What type of isomerism is exhibited by alkanes like butane and isobutane?
A. Chain isomerism B. Position isomerism
C. Structural isomerism D. Optical isomerism
28. How many structural isomers are possible for pentane (C5H12)?
A. 2 B. 3 C. 4 D. 5
29. Which of the following statements correctly explains why electrolysis is used to extract
highly reactive metals like aluminum?
A. They are more conductive in their native state
B. Their oxides are soluble in water
C. No reducing agent is strong enough to displace them from their compounds
D. They occur naturally as pure elements
30. In the extraction of iron in a blast furnace, the role of limestone is to:
A. Act as a reducing agent B. Convert iron ore to molten iron
C. Remove silica by forming slag D. Increase the temperature of the furnace
31. Why is aluminum used to make aircraft parts?
A. It is a poor conductor of electricity
B. It has a high melting point and is magnetic
C. It forms light alloys and resists corrosion
D. It reacts quickly with air, forming strong bonds
32. Which statement best describes the role of coke in the blast furnace during iron
extraction?
A. It acts as a flux to remove impurities
B. It reacts with nitrogen to form nitrides
 C. It provides the carbon needed to reduce iron oxide
D. It combines with limestone to form slag
33. Which of the following is not a correct property of metals?
A. Malleable B. Ductile C. Insulator of heat D. Sonorous
34. In the Contact Process, sulphur dioxide is converted to sulphur trioxide. This process is
important for the production of:
A. Sulphur hexafluoride B. Sulphuric acid
C. Nitric acid D. Sodium sulphate
35. Which gas is manufactured by the fractional distillation of liquefied air and reacts with
alkali metals to form nitrides?
A. Oxygen B. Nitrogen C. Chlorine D. Phosphorus
III. Fill in the blanks with the correct word or phrase related to organic chemistry.
1. Crude oil is separated into different useful components by a process called __________
distillation.
2. __________ is the phenomenon where compounds have the same molecular formula but
different structures.
3. Organic chemistry is the study of __________ compounds, both natural and synthetic.
4. Hydrocarbons are compounds composed of only __________ and __________ atoms.
5. Saturated hydrocarbons contain only __________ bonds between carbon atoms.
IV. Match the items in Column A with their correct process, source, or characteristic in
Column B.
Column A Column B
1. Red phosphorus A. Stable allotrope used in matchsticks
2. Chlorine B. Manufactured by electrolysis of brine
3. Metals (general property) C. Good conductors, ductile, malleable
4. Sulphur dioxide D. Formed when sulphur reacts with oxygen
5. White phosphorus E. Highly reactive; stored under water
6. Oxygen F. Forms basic oxides and is a reducing agent
7. Nitrogen G. Extracted by fractional distillation of liquefied air
8. Copper H. Extracted in a blast furnace
9. Iron I. Extracted by electrolysis of molten ore with cryolite
10. Aluminum J. Extracted by roasting chalcopyrite

V. Complete the following reaction equations with proper formula:

A. CH₃CH₂CH=CH₂ + HCl →
B. CH₃CH₂CH=CH₂ + Br₂( in the presence of light) →
C. CH₃CH₂CH=CH₂ + H₂O (H⁺ catalyst) →
D. CH4 + Br2 → _________+__________.
VI. Draw structures for the following IUPAC names.
A. 4-Ethyl-2,2-dimethylhexane
B. 3,3-Diethyl-4,5-dimethyl-1-nonyne
C. 4-ethyl-2,2,3-trimethylhexane
D. 3-bromo-2-chloro-1- hexane
VII. Name the following compounds (Write the correct IUPAC name)
A. CH3—CH(CH3)—C≡C—CH(Br)-CH(Cl)-CH(CH3)-CH3
B. CH3—CH=CH—CH(CH3)-CH(Br)-CH(Cl)—CH3
C. CH3—CH(CH3)-CH(Cl)-CH(CH3)—CH2—CH3
VIII. Write the balanced chemical equations for the combustion reactions of the following
hydrocarbons with oxygen: C₄H₁₀, C₄H₈, and C₄H₆.
A. C₄H₁₀ + O₂ →
B. C₄H₈ + O₂ →
C. C₄H₆ + O₂ →
 Legetafo Innovative Boarding Academy
"Grade 10 Chemistry Final Exam – 2nd Semester (2017 E.C.)"
Time allowed: 90 min
Name _____________________________Roll No___________sec._______
Answer sheet
Part one: true or false.
1.________. 2._______. 3._______. 4_______. 5_______.
6. ________. 7._______. 8._______. 9_______. 10_______.

Part two: multiple choices.

1.________ 11._______ 21.________ 31.______
2.________ 12.________ 22.________ 32.______
3.________ 13.________ 23.________ 33.______
4.________ 14.________ 24.________ 34.______
5.________ 15.________ 25.________ 35.______
6.________ 16.________ 26.________
7.________ 17.________ 27.________
8.________ 18.________ 28.________
9.________ 19.________ 29.________
10._______ 20.________ 30.________
Part III. Fill the blank space
1.________________________.
2.________________________.
3.________________________.
4.________________________and_________________________.
5.________________________.
Part IV; Matching
1.________. 2._______. 3._______. 4_______. 5_______.
6. ________. 7._______. 8._______. 9_______. 10_______.

Part V. complete reaction

A.______________________.
B.______________________.
C.______________________.
D._____________________and__________________________.
Part VI: Draw structures
A.

B.

C.

D.

Part Vll. IUPAC names.

A.

B.

C.

VIII. Combustion rxn

A.

B.
C.