Prijeđi na sadržaj

Lafutidin

Izvor: Wikipedija
Lafutidin
(IUPAC) ime
2-[(2-furilmetil)sulfinil]-N-((2Z)-4[4-(piperidin-1-ilmetil)piridin-2-il]oksi
Klinički podaci
Identifikatori
ATC kod ?
Hemijski podaci
Formula ?
Farmakoinformacioni podaci
Trudnoća ?
Pravni status

but-2-en-1-il)acetamid

| image = Lafutidine.png | width = 250 | image2 = | width2 =

| tradename = | Drugs.com = Internacionalno ime leka | pregnancy_AU = | pregnancy_US = | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = Oralno

| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

| CAS_number_Ref =  DaY | CAS_number = 118288-08-7 | ATC_prefix = A02 | ATC_suffix = BA08 | ATC_supplemental = | PubChem = 5282136 | IUPHAR_ligand = | ChEMBL_Ref = | ChEMBL = | DrugBank_Ref = Šablon:Drugbankcite | DrugBank = | UNII_Ref =  DaY | UNII = 49S4O7ADLC | KEGG_Ref =  DaY | KEGG = D01131

| chemical_formula = | C=22 | H=29 | N=3 | O=4 | S=1 | molecular_weight = 431,54 g/mol | smiles = C1CCN(CC1)CC2=CC(=NC=C2)OCC=CCNC(=O)CS(=O)CC3=CC=CO3 | InChI = | InChIKey = | StdInChI_Ref =  DaY | StdInChI = 1S/C22H29N3O4S/c26-21(18-30(27)17-20-7-6-14-28-20)23-9-2-5-13-29-22-15-19(8-10-24-22)16-25-11-3-1-4-12-25/h2,5-8,10,14-15H,1,3-4,9,11-13,16-18H2,(H,23,26)/b5-2- | StdInChIKey_Ref =  DaY | StdInChIKey = KMZQAVXSMUKBPD-DJWKRKHSSA-N }}

Lafutidin (INN) je antagonist H2 receptora.[1][2]

Reference

[uredi | uredi kod]
  1. Hardman JG, Limbird LE, Gilman AG. (2001). Goodman & Gilman's The Pharmacological Basis of Therapeutics (10 izd.). New York: McGraw-Hill. DOI:10.1036/0071422803. ISBN 0-07-135469-7. 
  2. Pdr Staff (2009). PDR: Physicians Desk Reference 2010 (Physicians' Desk Reference (Pdr)). Rozelle, N.S.W: Thomson Reuters. ISBN 1-56363-748-0. 

Vanjske veze

[uredi | uredi kod]
pFad - Phonifier reborn

Pfad - The Proxy pFad of © 2024 Garber Painting. All rights reserved.

Note: This service is not intended for secure transactions such as banking, social media, email, or purchasing. Use at your own risk. We assume no liability whatsoever for broken pages.


Alternative Proxies:

Alternative Proxy

pFad Proxy

pFad v3 Proxy

pFad v4 Proxy